"பென்பெரிடால்" பக்கத்தின் திருத்தங்களுக்கிடையேயான வேறுபாடு

1,731 பைட்டுகள் சேர்க்கப்பட்டது ,  3 ஆண்டுகளுக்கு முன்
தொகுப்பு சுருக்கம் இல்லை
சி (திருத்தம்)
{{Cleanup may 2017}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 459533587
| IUPAC_name = 1-{1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl}-1,3-dihydro-2''H''-benzimidazol-2-one
| image = Benperidol.svg
| alt = Skeletal formula of benperidol
| width = 240
| image2 = Benperidol 3D ball.png
| alt2 = Ball-and-stick model of the benperidol molecule
| width2 = 250
 
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|international|benperidol}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = Rx-only
| legal_status =
| routes_of_administration = Oral
 
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
 
<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 983-42-6
| ATC_prefix = N05
| ATC_suffix = AD07
| PubChem = 16363
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 15521
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 97O6X78C53
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 297302
 
<!--Chemical data-->
| C=22 | H=24
| F=1 | N=3
| O=2
| molecular_weight = 381.443 g/mol
| smiles = Fc1ccc(cc1)C(=O)CCCN4CCC(N3c2ccccc2NC3=O)CC4
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H24FN3O2/c23-17-9-7-16(8-10-17)21(27)6-3-13-25-14-11-18(12-15-25)26-20-5-2-1-4-19(20)24-22(26)28/h1-2,4-5,7-10,18H,3,6,11-15H2,(H,24,28)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FEBOTPHFXYHVPL-UHFFFAOYSA-N
}}
 
பென்பெரிடால் என்பது பியூடிரோ பீனோன் வழிப்பொருளைச் சார்ந்த ஆற்றல் மிகு மருந்தாகும். இது ஐரோப்பிய சந்தையில் மிகவும் திறன் வாய்ந்த 75 முதல் 100 வரை நிகர்மைத் தன்மை கொண்ட குளோர்புரோமசைன் உடைய   உளப்பினி மருந்தாகும். வேளை  மருந்தளவில் ஹாலோபெரிடால் உடன் ஒப்பிடும் பொழுது இது 150 முதல் 200 விழுக்காடு அதிகத் திறன்  வாய்ந்தது ஆகும்.<ref>Möller; Müller; Bandelow: Neuroleptika, 2001, WVG; {{ISBN|3-8047-1773-X}} (in German)</ref>
304

தொகுப்புகள்

"https://ta.wikipedia.org/wiki/சிறப்பு:MobileDiff/2299445" இருந்து மீள்விக்கப்பட்டது