"குளூட்டாமிக் காடி" பக்கத்தின் திருத்தங்களுக்கிடையேயான வேறுபாடு

3,050 பைட்டுகள் சேர்க்கப்பட்டது ,  9 ஆண்டுகளுக்கு முன்
சி
Quick-adding category "உயிர்வேதியியல்" (using HotCat)
சி (Quick-adding category "உயிர்வேதியியல்" (using HotCat))
{{chembox new
| ImageFileImageFileL1 = Glutaminsäure - Glutamic acid.svg
| verifiedrevid = 415508036
| ImageSizeL1 = 120px
| Name = குளுடாமிக் அமிலம்
| ImageFile1ImageFileR1 = L-glutamic-acid-3D-sticks2.png
| ImageFile = Glutaminsäure - Glutamic acid.svg
| ImageSizeR1 = 120px
| ImageFile1 = L-glutamic-acid-3D-sticks2.png
| IUPACName = (2S)-2-aminopentanedioic acid
| ImageSize1 = 180px
| OtherNames =
| ImageName1 = A representation of the structure of L-glutamic acid
| IUPACName = குளுடாமிக் அமிலம்
| OtherNames = 2-அமினோ பென்டேன்டையோயிக் அமிலம் <br/> (அ) 2-அமினோ குளுடாரிக் அமிலம்
| Section1 = {{Chembox Identifiers
| CASNo = 61756-6586-20
| UNII_Ref = {{fdacite|correct|FDA}}
| UNIIPubChem = 61LJO5I15S611
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 276389
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D04341
| InChI = 1/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)
| InChIKey = WHUUTDBJXJRKMK-UHFFFAOYAD
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WHUUTDBJXJRKMK-UHFFFAOYSA-N
| CASNo = 617-65-2
| CASNo_Ref = {{cascite|correct|CAS}}
| CASOther = <br/>56-86-0 (<small>L</small>-isomer)<br/>6893-26-1 (<small>D</small>-isomer) <!-- also verified at CAS Common Chemistry -->
| EC-number = 210-522-2
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 591
| SMILES = N[C@@H](CCCCC(=O)=O)C(C(=O)=O)N}}
| PubChem = 611
| IUPHAR_ligand = 1369
| SMILES = C(CC(=O)O)C(C(=O)O)N
}}
| Section2 = {{Chembox Properties
| C=5 | H=9 | N=1 | O=4
| Appearance = வெண் படிகப்பொடி
| Density = 1.4601 (20 °C)
| MeltingPt =
| MeltingPt = 199 °C சிதையும் தன்மை உள்ளது.
| BoilingPt =
| Solubility = 8.64 கி/லி (25 °C)
| Solubility = }}
| Section7Section3 = {{Chembox Hazards
| EUIndexMainHazards =
| FlashPt =
| Autoignition = }}
}}
 
'''குளூட்டாமிக் காடி''' (சுருக்கமாக '''Glu''' அல்லது '''E''') என்பது மாந்தர்களின் உடலியக்கத்திற்கு அடிப்படையாக உள்ள ஏறத்தாழ 20 [[அமினோ காடி]]களில் ஒன்று, ஆனால் மிகத்தேவையான அமினோகாடிகளில் ஒன்றல்ல. குளூட்டாமிக் காடியின் உப்பும், [[மின்மம்|எதிர்மின்மம்]] கொண்ட [[கார்பாக்சைலேட்|கார்பாக்சைலேட்டும்]] (carboxylate anion) குளூட்டாமேட் என்று அழைக்கப்படுகின்றது.
'''குளுடாமிக் அமிலம்''' (Glutamic acid) [குறுக்கம்: Glu (அ) E] அமிலத் தன்மையுள்ள ஒரு ஆல்ஃபா- [[அமினோ அமிலம்|அமினோ அமிலமாகும்]]. இதனுடைய வாய்பாடு: HOOC-CH(NH2)-(CH2)2-COOH (அ) C5H9NO4. இது ஒரு '''அத்தியாவசியமற்ற அமினோ அமிலமாகும்'''. இதன் குறிமுறையன்கள்: GAA மற்றும் GAG. கார்பாக்சிலேட் எதிர் மின்மங்களும், குளுடாமிக் அமில உப்புகளும் "குளுடமேட்" என்றழைக்கப்படுகின்றன. தனி வடிவமாக உள்ளபோது நரம்பு பரப்பியாகவும் (neurotransmitter), [[கிரப் சுழற்சி|கிரப் சுழற்சியில்]] வளர்சிதைமாற்ற இடைநிலையிலும் முக்கிய பங்கு வகிக்கின்றது.
 
== வேதியியல் ==
பக்கக் கிளை இணைப்பு கொண்ட [[கார்பாக்சைலிக் காடி]]யின் (carboxylic acid) வினைப்படும் பகுதி (functional group) காடி பிரிவுறும் எண் (acid dissociation constant) pK<sub>a</sub> = 4.1 கொண்டுள்ளது. உடலியக்க pH அளவில் இது [[மின்மம்|எதிர்மின்மம்]] கொண்ட (நேர்மினமம் களையப்பட்ட) கார்பாக்சைலேட்டு (carboxylate) வடிவில் உள்ளது.
 
== வரலாறு ==
இந்த குளூட்டாமிக் காடியை 1908 இல் [[சப்பான்|நிப்பானைச்]] சேர்ந்த பேராசிரியர் [[கிக்குனே இக்கேடா]] (Kikunae Ikeda), டோக்கியோ அரசக பல்கலைக்கழகத்துல் கண்டுபிடித்தார். இவர் கடல்பாசி போன்ற கடல் களைச்செடி எனக் கருதப்படும் கொம்பு (Kombu) என்னும் செடியில் இருந்து குளூட்டாமிக் காடியை பிரித்தெடுத்தார். இதில் இருந்து பெறும் குளூட்டாமேட் என்னும் பொருள், சுவை மிக்கதாக நாவில் உணரும் [[உமாமி]] என்னும் சுவையைத் தருவதாகக் கண்டுபிடித்தார். அறிவியலில் [[இனிப்பு]], [[கசப்பு]], [[புளிப்பு]], [[உவர்ப்பு]] (கரிப்பு) ஆகிய நான்கு சுவைகளைப் போல [[நாக்கு|நாவில்]] உணரும் புதிய ஐந்தாவது சுவையாக இந்த உமாமி இருப்பதாகக் கணக்கிடுகிறார்கள்<ref>[http://nytimes.com/2008/03/05/dining/05glute.html?pagewanted=2&sq=umami&st=nyt&scp=4 2008 இல் வெளியான நியூ யார்க் டைம்சு கட்டுரை]</ref>
 
. இதனால் இந்த குளூட்டாமேட் என்னும் பொருள் பல உணவுப்பொருள்களில் சுவைகூட்டியாக (சுவையூட்டியாக) சேர்க்கப்படுகின்றது. இந்த சுவையூட்டி பெரும்பாலும் [[மோனோ சோடியம் குளூட்டாமேட்|மோனோ சோடியம் குளூட்டாமேட்டாக]] இருக்கின்றது.
 
 
 
== மேற்கோள்களும் குறிப்புகளும் ==
<references/>
 
== மேலும் படிக்க ==
* Nelson DL and Cox MM. ''Lehninger Principles of Biochemistry'', 4th edition.
 
[[பகுப்பு:அமினோ காடிகள்]]
[[பகுப்பு:நரம்பன் செலுத்திகள்]]
[[பகுப்பு:சுவையூட்டிகள்]]
[[பகுப்பு:உமாமி சுவைகூட்டிகள்]]
[[பகுப்பு:குளூட்டாமேட்டுகள்]]
[[பகுப்பு:உயிர்வேதியியல்]]
 
[[bn:গ্লুটামিক অ্যাসিড]]
[[ca:Àcid glutàmic]]
[[cs:Kyselina glutamová]]
[[da:Glutaminsyre]]
[[de:Glutaminsäure]]
[[en:Glutamic acid]]
[[eo:Glutama acido]]
[[es:Ácido glutámico]]
[[eu:Azido glutamiko]]
[[fa:اسید گلوتامیک]]
[[fi:Glutamiinihappo]]
[[fr:Acide glutamique]]
[[he:חומצה גלוטמית]]
[[hr:Glutaminska kiselina]]
[[hu:Glutaminsav]]
[[id:Asam glutamat]]
[[it:Acido glutammico]]
[[ja:グルタミン酸]]
[[ko:글루탐산]]
[[lb:Glutamat]]
[[lt:Glutamo rūgštis]]
[[lv:Glutamīnskābe]]
[[nl:Glutaminezuur]]
[[no:Glutaminsyre]]
[[oc:Acid glutamic]]
[[pl:Kwas glutaminowy]]
[[pt:Ácido glutâmico]]
[[ru:Глутаминовая кислота]]
[[sk:Kyselina glutámová]]
[[sl:Glutaminska kislina]]
[[sr:Glutaminska kiselina]]
[[sv:Glutaminsyra]]
[[th:กลูตาเมต]]
[[tr:Glutamik asit]]
[[uk:Глутамінова кислота]]
[[zh:穀氨酸]]
[[zh-min-nan:Glutamine sng]]
51,759

தொகுப்புகள்

"https://ta.wikipedia.org/wiki/சிறப்பு:MobileDiff/802779" இருந்து மீள்விக்கப்பட்டது